CAS 1095624-31-9 is the registry number for 5-Methyl-2-((2,2,2-trifluoroethyl)sulfanyl)aniline. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-methyl-2-(2,2,2-trifluoroethylsulfanyl)aniline (CAS 1095624-31-9) is a chemical compound with the molecular formula C9H10F3NS and a molecular weight of 221.24 g/mol. IUPAC name: 5-methyl-2-(2,2,2-trifluoroethylsulfanyl)aniline. InChIKey: QOKADNKYDDRNET-UHFFFAOYSA-N.
| Molecular formula | C9H10F3NS |
|---|---|
| Molecular weight | 221.24 g/mol |
| IUPAC name | 5-methyl-2-(2,2,2-trifluoroethylsulfanyl)aniline |
| InChIKey | QOKADNKYDDRNET-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)SCC(F)(F)F)N |
Computed by PubChem (NCBI)