CAS 782-01-4 appears in our catalog under these names: Pitavastatin Impurity 84, Pitavastatin Impurity 27. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2-aminophenyl)-(3-fluorophenyl)methanone (CAS 782-01-4) is a chemical compound with the molecular formula C13H10FNO and a molecular weight of 215.22 g/mol. IUPAC name: (2-aminophenyl)-(3-fluorophenyl)methanone. InChIKey: GPJUYTLMEAYQSS-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO |
|---|---|
| Molecular weight | 215.22 g/mol |
| IUPAC name | (2-aminophenyl)-(3-fluorophenyl)methanone |
| InChIKey | GPJUYTLMEAYQSS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC(=CC=C2)F)N |
Computed by PubChem (NCBI)