CAS 1005585-51-2 is the registry number for 2-(3-Difluoromethyl-5-methyl-pyrazol-1-yl)-propionic acid ethyl ester, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
Ethyl 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]propanoate (CAS 1005585-51-2) is a chemical compound with the molecular formula C10H14F2N2O2 and a molecular weight of 232.23 g/mol. IUPAC name: ethyl 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]propanoate. InChIKey: JNEXRLYGHGVPLV-UHFFFAOYSA-N.
| Molecular formula | C10H14F2N2O2 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | ethyl 2-[3-(difluoromethyl)-5-methylpyrazol-1-yl]propanoate |
| InChIKey | JNEXRLYGHGVPLV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)N1C(=CC(=N1)C(F)F)C |
Computed by PubChem (NCBI)