Products 1823442-43-8

CAS 1823442-43-8 is the registry number for Ethyl 2-(3-(difluoromethyl)-1H-pyrazol-1-yl)butanoate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-[3-(difluoromethyl)pyrazol-1-yl]butanoate (CAS 1823442-43-8) is a chemical compound with the molecular formula C10H14F2N2O2 and a molecular weight of 232.23 g/mol. IUPAC name: ethyl 2-[3-(difluoromethyl)pyrazol-1-yl]butanoate. InChIKey: WWXRTJDFPPNBPX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14F2N2O2
Molecular weight232.23 g/mol
IUPAC nameethyl 2-[3-(difluoromethyl)pyrazol-1-yl]butanoate
InChIKeyWWXRTJDFPPNBPX-UHFFFAOYSA-N
SMILESCCC(C(=O)OCC)N1C=CC(=N1)C(F)F

Computed by PubChem (NCBI)