Products 1824348-84-6

CAS 1824348-84-6 is the registry number for tert-Butyl 2-cyano-4,4-difluoropyrrolidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-cyano-4,4-difluoropyrrolidine-1-carboxylate (CAS 1824348-84-6) is a chemical compound with the molecular formula C10H14F2N2O2 and a molecular weight of 232.23 g/mol. IUPAC name: tert-butyl 2-cyano-4,4-difluoropyrrolidine-1-carboxylate. InChIKey: NZUSVVISTGILKC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14F2N2O2
Molecular weight232.23 g/mol
IUPAC nametert-butyl 2-cyano-4,4-difluoropyrrolidine-1-carboxylate
InChIKeyNZUSVVISTGILKC-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC(CC1C#N)(F)F

Computed by PubChem (NCBI)