Products 1005591-87-6
CAS 1005591-87-6 is the registry number for 5-Furan-2-yl-2-phenyl-2H-pyrazol-3-ol, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
5-(furan-2-yl)-2-phenyl-1H-pyrazol-3-one (CAS 1005591-87-6) is a chemical compound with the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. IUPAC name: 5-(furan-2-yl)-2-phenyl-1H-pyrazol-3-one. InChIKey: ZBHVSBDOLDEVJU-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 5-(furan-2-yl)-2-phenyl-1H-pyrazol-3-one |
| InChIKey | ZBHVSBDOLDEVJU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C=C(N2)C3=CC=CO3 |
Computed by PubChem (NCBI)