CAS 439095-55-3 is the registry number for Cyanomethyl 4-(1h-pyrrol-1-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Cyanomethyl 4-pyrrol-1-ylbenzoate (CAS 439095-55-3) is a chemical compound with the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. IUPAC name: cyanomethyl 4-pyrrol-1-ylbenzoate. InChIKey: FQRPMCADPCYWTN-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | cyanomethyl 4-pyrrol-1-ylbenzoate |
| InChIKey | FQRPMCADPCYWTN-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=CC=C(C=C2)C(=O)OCC#N |
Computed by PubChem (NCBI)