CAS 1562-93-2 appears in our catalog under these names: 4-(2-Phenyldiazenyl)benzoic acid, 95%, 95%, 4-(Phenylazo)benzoic acid, 97%, 4–(Phenyldiazenyl)benzoic acid, 4-(Phenylazo)benzoic Acid, >98.0%(T), 4-(PHENYLAZO)BENZOIC ACID, 98%. Offered by: Chemat, Combi-blocks, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: 1g, 5g, 25g, 100g, 100mg, 250mg, 10g, 10mM (in 1ml dmso).
4-phenyldiazenylbenzoic acid (CAS 1562-93-2) is a chemical compound with the molecular formula C13H10N2O2 and a molecular weight of 226.23 g/mol. IUPAC name: 4-phenyldiazenylbenzoic acid. InChIKey: CSPTZWQFHBVOLO-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O2 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 4-phenyldiazenylbenzoic acid |
| InChIKey | CSPTZWQFHBVOLO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)