CAS 1005668-69-8 appears in our catalog under these names: 2-(4-Nitro-1h-pyrazol-1-yl)butanohydrazide, 95%, 2-(4-Nitro-1H-pyrazol-1-yl)butanehydrazide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(4-nitropyrazol-1-yl)butanehydrazide (CAS 1005668-69-8) is a chemical compound with the molecular formula C7H11N5O3 and a molecular weight of 213.19 g/mol. IUPAC name: 2-(4-nitropyrazol-1-yl)butanehydrazide. InChIKey: BZSQGGHCPRDMRH-UHFFFAOYSA-N.
| Molecular formula | C7H11N5O3 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 2-(4-nitropyrazol-1-yl)butanehydrazide |
| InChIKey | BZSQGGHCPRDMRH-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)NN)N1C=C(C=N1)[N+](=O)[O-] |
Computed by PubChem (NCBI)