CAS 36576-45-1 appears in our catalog under these names: Terbuthylazine metabolite LM2, Terbuthylazine TP CSAA036479 (LM2), Terbuthylazine TP CSAA036479 (LM2), Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Dr. Ehrenstorfer, HPC Standards. Available pack sizes: 10mg, 1x10mg, 1x1ml.
2-[(2-amino-6-oxo-1H-1,3,5-triazin-4-yl)amino]-2-methylpropanoic acid (CAS 36576-45-1) is a chemical compound with the molecular formula C7H11N5O3 and a molecular weight of 213.19 g/mol. IUPAC name: 2-[(2-amino-6-oxo-1H-1,3,5-triazin-4-yl)amino]-2-methylpropanoic acid. InChIKey: QKOJUBFULGSCQS-UHFFFAOYSA-N.
| Molecular formula | C7H11N5O3 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 2-[(2-amino-6-oxo-1H-1,3,5-triazin-4-yl)amino]-2-methylpropanoic acid |
| InChIKey | QKOJUBFULGSCQS-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)NC1=NC(=O)NC(=N1)N |
Computed by PubChem (NCBI)