Products 883-73-8
CAS 883-73-8 is the registry number for 2-(Dimethylamino)-6-(methylamino)-5-nitropyrimidin-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(dimethylamino)-4-(methylamino)-5-nitro-1H-pyrimidin-6-one (CAS 883-73-8) is a chemical compound with the molecular formula C7H11N5O3 and a molecular weight of 213.19 g/mol. IUPAC name: 2-(dimethylamino)-4-(methylamino)-5-nitro-1H-pyrimidin-6-one. InChIKey: BJMDOQQABXMFRE-UHFFFAOYSA-N.
| Molecular formula | C7H11N5O3 |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | 2-(dimethylamino)-4-(methylamino)-5-nitro-1H-pyrimidin-6-one |
| InChIKey | BJMDOQQABXMFRE-UHFFFAOYSA-N |
| SMILES | CNC1=C(C(=O)NC(=N1)N(C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)