CAS 1005907-96-9 is the registry number for N-Ethyl-1,5-dimethyl-1H-pyrazole-4-sulfonamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-ethyl-1,5-dimethylpyrazole-4-sulfonamide (CAS 1005907-96-9) is a chemical compound with the molecular formula C7H13N3O2S and a molecular weight of 203.26 g/mol. IUPAC name: N-ethyl-1,5-dimethylpyrazole-4-sulfonamide. InChIKey: YOTIZYDEDDEXDP-UHFFFAOYSA-N.
| Molecular formula | C7H13N3O2S |
|---|---|
| Molecular weight | 203.26 g/mol |
| IUPAC name | N-ethyl-1,5-dimethylpyrazole-4-sulfonamide |
| InChIKey | YOTIZYDEDDEXDP-UHFFFAOYSA-N |
| SMILES | CCNS(=O)(=O)C1=C(N(N=C1)C)C |
Computed by PubChem (NCBI)