CAS 1249944-44-2 appears in our catalog under these names: 1-Ethyl-3,5-dimethyl-1h-pyrazole-4-sulfonamide, 95%, 1-Ethyl-3,5-dimethyl-1H-pyrazole-4-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-ethyl-3,5-dimethylpyrazole-4-sulfonamide (CAS 1249944-44-2) is a chemical compound with the molecular formula C7H13N3O2S and a molecular weight of 203.26 g/mol. IUPAC name: 1-ethyl-3,5-dimethylpyrazole-4-sulfonamide. InChIKey: BWDPJUPWEIZDIZ-UHFFFAOYSA-N.
| Molecular formula | C7H13N3O2S |
|---|---|
| Molecular weight | 203.26 g/mol |
| IUPAC name | 1-ethyl-3,5-dimethylpyrazole-4-sulfonamide |
| InChIKey | BWDPJUPWEIZDIZ-UHFFFAOYSA-N |
| SMILES | CCN1C(=C(C(=N1)C)S(=O)(=O)N)C |
Computed by PubChem (NCBI)