CAS 1854356-66-3 is the registry number for 3-((1,4,5,6-Tetrahydropyrimidin-2-yl)amino)thietane 1,1-dioxide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,1-dioxothietan-3-yl)-1,4,5,6-tetrahydropyrimidin-2-amine (CAS 1854356-66-3) is a chemical compound with the molecular formula C7H13N3O2S and a molecular weight of 203.26 g/mol. IUPAC name: N-(1,1-dioxothietan-3-yl)-1,4,5,6-tetrahydropyrimidin-2-amine. InChIKey: UASVAPLJAKGHOL-UHFFFAOYSA-N.
| Molecular formula | C7H13N3O2S |
|---|---|
| Molecular weight | 203.26 g/mol |
| IUPAC name | N-(1,1-dioxothietan-3-yl)-1,4,5,6-tetrahydropyrimidin-2-amine |
| InChIKey | UASVAPLJAKGHOL-UHFFFAOYSA-N |
| SMILES | C1CNC(=NC1)NC2CS(=O)(=O)C2 |
Computed by PubChem (NCBI)