CAS 100594-33-0 is the registry number for (2S)-2-Amino-2,3-dimethyl-butanenitrile L-(+)-Tartaric Acid. Offered by: TRC. Available pack sizes: 2,5g, 25g.
(2S)-2-amino-2,3-dimethylbutanenitrile;(2R,3R)-2,3-dihydroxybutanedioic acid (CAS 100594-33-0) is a chemical compound with the molecular formula C10H18N2O6 and a molecular weight of 262.26 g/mol. IUPAC name: (2S)-2-amino-2,3-dimethylbutanenitrile;(2R,3R)-2,3-dihydroxybutanedioic acid. InChIKey: XBSQEOQUUVTLMF-XOJLQXRJSA-N.
| Molecular formula | C10H18N2O6 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | (2S)-2-amino-2,3-dimethylbutanenitrile;(2R,3R)-2,3-dihydroxybutanedioic acid |
| InChIKey | XBSQEOQUUVTLMF-XOJLQXRJSA-N |
| SMILES | CC(C)[C@@](C)(C#N)N.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)