Products 2044871-41-0

CAS 2044871-41-0 is the registry number for 1,4-Dioxaspiro(4.5)decan-8-ylhydrazine oxalate. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.

Structural formula: {0} (CAS {1})

1,4-dioxaspiro[4.5]decan-8-ylhydrazine;oxalic acid (CAS 2044871-41-0) is a chemical compound with the molecular formula C10H18N2O6 and a molecular weight of 262.26 g/mol. IUPAC name: 1,4-dioxaspiro[4.5]decan-8-ylhydrazine;oxalic acid. InChIKey: WDHMJIFKFQJRKY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18N2O6
Molecular weight262.26 g/mol
IUPAC name1,4-dioxaspiro[4.5]decan-8-ylhydrazine;oxalic acid
InChIKeyWDHMJIFKFQJRKY-UHFFFAOYSA-N
SMILESC1CC2(CCC1NN)OCCO2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)