Products 174569-25-6
CAS 174569-25-6 appears in our catalog under these names: MeO-PEG(25)-NHS, m-PEG24-NHS ester, 95%, m-PEG37-NHS ester, 95%, m-PEG12-NHS ester, 95%, m-PEG16-NHS ester, 95%. Offered by: Iris Biotech, Combi-blocks, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg, 50mg, Get quote.
Azane;(2,5-dioxopyrrolidin-1-yl) 3-(2-methoxyethoxy)propanoate (CAS 174569-25-6) is a chemical compound with the molecular formula C10H18N2O6 and a molecular weight of 262.26 g/mol. IUPAC name: azane;(2,5-dioxopyrrolidin-1-yl) 3-(2-methoxyethoxy)propanoate. InChIKey: YVAZBTZZWBTHMF-UHFFFAOYSA-N.
| Molecular formula | C10H18N2O6 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | azane;(2,5-dioxopyrrolidin-1-yl) 3-(2-methoxyethoxy)propanoate |
| InChIKey | YVAZBTZZWBTHMF-UHFFFAOYSA-N |
| SMILES | COCCOCCC(=O)ON1C(=O)CCC1=O.N |
Computed by PubChem (NCBI)