CAS 100595-93-5 is the registry number for 3-O-acetyl Padmatin. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R)-2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-4-oxo-2,3-dihydrochromen-3-yl] acetate (CAS 100595-93-5) is a chemical compound with the molecular formula C18H16O8 and a molecular weight of 360.3 g/mol. IUPAC name: [(2R,3R)-2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-4-oxo-2,3-dihydrochromen-3-yl] acetate. InChIKey: WWYQJKVSCKMFCP-MSOLQXFVSA-N.
| Molecular formula | C18H16O8 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | [(2R,3R)-2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-4-oxo-2,3-dihydrochromen-3-yl] acetate |
| InChIKey | WWYQJKVSCKMFCP-MSOLQXFVSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H](OC2=CC(=CC(=C2C1=O)O)OC)C3=CC(=C(C=C3)O)O |
Computed by PubChem (NCBI)