CAS 31996-10-8 appears in our catalog under these names: Tetramethyl naphthalene–1,4,5,8–tetracarboxylate, Tetramethyl naphthalene-1,4,5,8-tetracarboxylate, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 50mg, 250mg, 100mg.
Tetramethyl naphthalene-1,4,5,8-tetracarboxylate (CAS 31996-10-8) is a chemical compound with the molecular formula C18H16O8 and a molecular weight of 360.3 g/mol. IUPAC name: tetramethyl naphthalene-1,4,5,8-tetracarboxylate. InChIKey: QGAXWPQVFUUSGN-UHFFFAOYSA-N.
| Molecular formula | C18H16O8 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | tetramethyl naphthalene-1,4,5,8-tetracarboxylate |
| InChIKey | QGAXWPQVFUUSGN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC=C(C2=C(C=C1)C(=O)OC)C(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)