CAS 578-71-2 is the registry number for 3,4',5-Trihydroxy-3',6,7-Trimethoxyflavone. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7-dimethoxychromen-4-one (CAS 578-71-2) is a chemical compound with the molecular formula C18H16O8 and a molecular weight of 360.3 g/mol. IUPAC name: 3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7-dimethoxychromen-4-one. InChIKey: RQJFJWHHIIPKGW-UHFFFAOYSA-N.
| Molecular formula | C18H16O8 |
|---|---|
| Molecular weight | 360.3 g/mol |
| IUPAC name | 3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-6,7-dimethoxychromen-4-one |
| InChIKey | RQJFJWHHIIPKGW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC)OC)O)O)O |
Computed by PubChem (NCBI)