CAS 1006-03-7 appears in our catalog under these names: Cyclohexanone-2,2,6,6-d4, 95%, Cyclohexanone-2,2,6,6-d4, 98 atom % D, min 98% Chemical Purity, Cyclohexanone–2,2,6,6–d4, CYCLOHEXANONE-2,2,6,6-D4, 99 ATOM % D. Offered by: Combi-blocks, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 5g, 1g.
2,2,6,6-tetradeuteriocyclohexan-1-one (CAS 1006-03-7) is a chemical compound with the molecular formula C6H10O and a molecular weight of 102.17 g/mol. IUPAC name: 2,2,6,6-tetradeuteriocyclohexan-1-one. InChIKey: JHIVVAPYMSGYDF-CQOLUAMGSA-N.
| Molecular formula | C6H10O |
|---|---|
| Molecular weight | 102.17 g/mol |
| IUPAC name | 2,2,6,6-tetradeuteriocyclohexan-1-one |
| InChIKey | JHIVVAPYMSGYDF-CQOLUAMGSA-N |
| SMILES | [2H]C1(CCCC(C1=O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)