Products 334689-56-4
CAS 334689-56-4 is the registry number for Cyclohexanone-13C6. Offered by: TRC. Available pack sizes: 25mg.
(1,2,3,4,5,6-13C6)cyclohexanone (CAS 334689-56-4) is a chemical compound with the molecular formula C6H10O and a molecular weight of 104.099 g/mol. IUPAC name: (1,2,3,4,5,6-13C6)cyclohexanone. InChIKey: JHIVVAPYMSGYDF-IDEBNGHGSA-N.
| Molecular formula | C6H10O |
|---|---|
| Molecular weight | 104.099 g/mol |
| IUPAC name | (1,2,3,4,5,6-13C6)cyclohexanone |
| InChIKey | JHIVVAPYMSGYDF-IDEBNGHGSA-N |
| SMILES | [13CH2]1[13CH2][13CH2][13C](=O)[13CH2][13CH2]1 |
Computed by PubChem (NCBI)