CAS 54513-99-4 appears in our catalog under these names: Cyclohexanone-d6, Cyclohexanone-3,3,4,4,5,5-d6, 98 atom % D, min 98% Chemical Purity, Cyclohexanone–d6. Offered by: TRC, CDN, GLPBio. Available pack sizes: 100mg, 1g, 2,5g, 0,5g, 10mg.
3,3,4,4,5,5-hexadeuteriocyclohexan-1-one (CAS 54513-99-4) is a chemical compound with the molecular formula C6H10O and a molecular weight of 104.18 g/mol. IUPAC name: 3,3,4,4,5,5-hexadeuteriocyclohexan-1-one. InChIKey: JHIVVAPYMSGYDF-NMFSSPJFSA-N.
| Molecular formula | C6H10O |
|---|---|
| Molecular weight | 104.18 g/mol |
| IUPAC name | 3,3,4,4,5,5-hexadeuteriocyclohexan-1-one |
| InChIKey | JHIVVAPYMSGYDF-NMFSSPJFSA-N |
| SMILES | [2H]C1(CC(=O)CC(C1([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)