CAS 1006002-58-9 is the registry number for ICOS-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-[(3,4-dichlorophenyl)methoxy]-2-methyl-6-(1H-pyrazol-5-yl)phenol (CAS 1006002-58-9) is a chemical compound with the molecular formula C17H14Cl2N2O2 and a molecular weight of 349.2 g/mol. IUPAC name: 3-[(3,4-dichlorophenyl)methoxy]-2-methyl-6-(1H-pyrazol-5-yl)phenol. InChIKey: GNTDIXSFVUOIDD-UHFFFAOYSA-N.
| Molecular formula | C17H14Cl2N2O2 |
|---|---|
| Molecular weight | 349.2 g/mol |
| IUPAC name | 3-[(3,4-dichlorophenyl)methoxy]-2-methyl-6-(1H-pyrazol-5-yl)phenol |
| InChIKey | GNTDIXSFVUOIDD-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1O)C2=CC=NN2)OCC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)