CAS 21412-80-6 is the registry number for 2-(2,6-Dichlorobenzyl)-1-(nitromethyl)-1,2-dihydroisoquinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[(2,6-dichlorophenyl)methyl]-1-(nitromethyl)-1H-isoquinoline (CAS 21412-80-6) is a chemical compound with the molecular formula C17H14Cl2N2O2 and a molecular weight of 349.2 g/mol. IUPAC name: 2-[(2,6-dichlorophenyl)methyl]-1-(nitromethyl)-1H-isoquinoline. InChIKey: RXWVHONZSNOENW-UHFFFAOYSA-N.
| Molecular formula | C17H14Cl2N2O2 |
|---|---|
| Molecular weight | 349.2 g/mol |
| IUPAC name | 2-[(2,6-dichlorophenyl)methyl]-1-(nitromethyl)-1H-isoquinoline |
| InChIKey | RXWVHONZSNOENW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(N(C=CC2=C1)CC3=C(C=CC=C3Cl)Cl)C[N+](=O)[O-] |
Computed by PubChem (NCBI)