CAS 1024297-59-3 is the registry number for 4-chloro-3-((3-chlorophenoxy)methyl)-2-methyl-1-phenyl-3-pyrazolin-5-one. Offered by: Biosynth. Available pack sizes: 250mg.
4-chloro-5-[(3-chlorophenoxy)methyl]-1-methyl-2-phenylpyrazol-3-one (CAS 1024297-59-3) is a chemical compound with the molecular formula C17H14Cl2N2O2 and a molecular weight of 349.2 g/mol. IUPAC name: 4-chloro-5-[(3-chlorophenoxy)methyl]-1-methyl-2-phenylpyrazol-3-one. InChIKey: ZYQDQIQEIPLFRE-UHFFFAOYSA-N.
| Molecular formula | C17H14Cl2N2O2 |
|---|---|
| Molecular weight | 349.2 g/mol |
| IUPAC name | 4-chloro-5-[(3-chlorophenoxy)methyl]-1-methyl-2-phenylpyrazol-3-one |
| InChIKey | ZYQDQIQEIPLFRE-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=O)N1C2=CC=CC=C2)Cl)COC3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)