CAS 100607-08-7 is the registry number for Orazamide Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
3-amino-3-imino-2-phenyldiazenylpropanamide (CAS 100607-08-7) is a chemical compound with the molecular formula C9H11N5O and a molecular weight of 205.22 g/mol. IUPAC name: 3-amino-3-imino-2-phenyldiazenylpropanamide. InChIKey: IWQCRGGEGLIWHV-UHFFFAOYSA-N.
| Molecular formula | C9H11N5O |
|---|---|
| Molecular weight | 205.22 g/mol |
| IUPAC name | 3-amino-3-imino-2-phenyldiazenylpropanamide |
| InChIKey | IWQCRGGEGLIWHV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC(C(=N)N)C(=O)N |
Computed by PubChem (NCBI)