CAS 442910-18-1 is the registry number for 6-(5-Methylfuran-2-yl)pyrimidine-2,4,5-triamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(5-methylfuran-2-yl)pyrimidine-2,4,5-triamine (CAS 442910-18-1) is a chemical compound with the molecular formula C9H11N5O and a molecular weight of 205.22 g/mol. IUPAC name: 6-(5-methylfuran-2-yl)pyrimidine-2,4,5-triamine. InChIKey: NFCAXMYSRSNRRA-UHFFFAOYSA-N.
| Molecular formula | C9H11N5O |
|---|---|
| Molecular weight | 205.22 g/mol |
| IUPAC name | 6-(5-methylfuran-2-yl)pyrimidine-2,4,5-triamine |
| InChIKey | NFCAXMYSRSNRRA-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(O1)C2=C(C(=NC(=N2)N)N)N |
Computed by PubChem (NCBI)