CAS 1152534-41-2 appears in our catalog under these names: 4-(3-Cyclopropyl-1,2,4-oxadiazol-5-yl)-1-methyl-1h-pyrazol-5-amine, 95%, 4-(3-Cyclopropyl-1,2,4-oxadiazol-5-yl)-1-methyl-1H-pyrazol-5-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-1-methylpyrazol-5-amine (CAS 1152534-41-2) is a chemical compound with the molecular formula C9H11N5O and a molecular weight of 205.22 g/mol. IUPAC name: 4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-1-methylpyrazol-5-amine. InChIKey: UOOKPCHLWPOOPO-UHFFFAOYSA-N.
| Molecular formula | C9H11N5O |
|---|---|
| Molecular weight | 205.22 g/mol |
| IUPAC name | 4-(3-cyclopropyl-1,2,4-oxadiazol-5-yl)-1-methylpyrazol-5-amine |
| InChIKey | UOOKPCHLWPOOPO-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)C2=NC(=NO2)C3CC3)N |
Computed by PubChem (NCBI)