CAS 100612-75-7 appears in our catalog under these names: 3-(4-tert-Butylphenyl)-2-oxopropanoic acid, 4-(1,1-Dimethylethyl)-α-oxobenzenepropanoic acid, 97%, 97%, 4-(1,1-Dimethylethyl)-α-oxobenzenepropanoic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g.
3-(4-tert-butylphenyl)-2-oxopropanoic acid (CAS 100612-75-7) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 3-(4-tert-butylphenyl)-2-oxopropanoic acid. InChIKey: HXQKWGQEVYRRIT-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 3-(4-tert-butylphenyl)-2-oxopropanoic acid |
| InChIKey | HXQKWGQEVYRRIT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CC(=O)C(=O)O |
Computed by PubChem (NCBI)