Products 1006302-79-9

CAS 1006302-79-9 is the registry number for 3,5-Dichloro-2,6-difluoro-4-pyridineacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3,5-dichloro-2,6-difluoro-4-pyridinyl)acetic acid (CAS 1006302-79-9) is a chemical compound with the molecular formula C7H3Cl2F2NO2 and a molecular weight of 242.00 g/mol. IUPAC name: 2-(3,5-dichloro-2,6-difluoro-4-pyridinyl)acetic acid. InChIKey: SGLXACHKHUYVJQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H3Cl2F2NO2
Molecular weight242.00 g/mol
IUPAC name2-(3,5-dichloro-2,6-difluoro-4-pyridinyl)acetic acid
InChIKeySGLXACHKHUYVJQ-UHFFFAOYSA-N
SMILESC(C1=C(C(=NC(=C1Cl)F)F)Cl)C(=O)O

Computed by PubChem (NCBI)