CAS 1823778-65-9 appears in our catalog under these names: 2–(3,5–dichloropyridin–2–yl)–2,2–difluoroacetic acid, 2-(3,5-dichloropyridin-2-yl)-2,2-difluoroacetic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 200mg, 5g.
2-(3,5-dichloro-2-pyridinyl)-2,2-difluoroacetic acid (CAS 1823778-65-9) is a chemical compound with the molecular formula C7H3Cl2F2NO2 and a molecular weight of 242.00 g/mol. IUPAC name: 2-(3,5-dichloro-2-pyridinyl)-2,2-difluoroacetic acid. InChIKey: OANJZELODQLGOE-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F2NO2 |
|---|---|
| Molecular weight | 242.00 g/mol |
| IUPAC name | 2-(3,5-dichloro-2-pyridinyl)-2,2-difluoroacetic acid |
| InChIKey | OANJZELODQLGOE-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)C(C(=O)O)(F)F)Cl |
Computed by PubChem (NCBI)