CAS 2228830-43-9 appears in our catalog under these names: 2-(2,6-Dichloropyridin-4-yl)-2,2-difluoroacetic acid, 98%, 2,6-Dichloro-α,α-difluoro-4-pyridineacetic acid, 95%, 95%, 2,6-Dichloro-α,α-difluoro-4-pyridineacetic acid, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 500mg.
2-(2,6-dichloro-4-pyridinyl)-2,2-difluoroacetic acid (CAS 2228830-43-9) is a chemical compound with the molecular formula C7H3Cl2F2NO2 and a molecular weight of 242.00 g/mol. IUPAC name: 2-(2,6-dichloro-4-pyridinyl)-2,2-difluoroacetic acid. InChIKey: FOUXMTYAGUJNOW-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F2NO2 |
|---|---|
| Molecular weight | 242.00 g/mol |
| IUPAC name | 2-(2,6-dichloro-4-pyridinyl)-2,2-difluoroacetic acid |
| InChIKey | FOUXMTYAGUJNOW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Cl)Cl)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)