CAS 1006327-67-8 is the registry number for 1,3-Bis(1,3-dimethyl-1H-pyrazol-4-yl)-2-methylpropane-1,3-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-bis(1,3-dimethylpyrazol-4-yl)-2-methylpropane-1,3-dione (CAS 1006327-67-8) is a chemical compound with the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. IUPAC name: 1,3-bis(1,3-dimethylpyrazol-4-yl)-2-methylpropane-1,3-dione. InChIKey: HMHCSIOCPKWVKS-UHFFFAOYSA-N.
| Molecular formula | C14H18N4O2 |
|---|---|
| Molecular weight | 274.32 g/mol |
| IUPAC name | 1,3-bis(1,3-dimethylpyrazol-4-yl)-2-methylpropane-1,3-dione |
| InChIKey | HMHCSIOCPKWVKS-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1C(=O)C(C)C(=O)C2=CN(N=C2C)C)C |
Computed by PubChem (NCBI)