Products 1887742-42-8
CAS 1887742-42-8 appears in our catalog under these names: ADB-INACA, >95% (HPLC), ADB–INACA. Offered by: TRC, GLPBio. Available pack sizes: 25mg, 5mg, 1mg.
N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1H-indazole-3-carboxamide (CAS 1887742-42-8) is a chemical compound with the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. IUPAC name: N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1H-indazole-3-carboxamide. InChIKey: UFECWXZSRFBSHC-LLVKDONJSA-N.
| Molecular formula | C14H18N4O2 |
|---|---|
| Molecular weight | 274.32 g/mol |
| IUPAC name | N-[(2S)-1-amino-3,3-dimethyl-1-oxobutan-2-yl]-1H-indazole-3-carboxamide |
| InChIKey | UFECWXZSRFBSHC-LLVKDONJSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)N)NC(=O)C1=NNC2=CC=CC=C21 |
Computed by PubChem (NCBI)