CAS 1346602-49-0 is the registry number for Ormetoprim-d6. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg.
5-[[2-methyl-4,5-bis(trideuteriomethoxy)phenyl]methyl]pyrimidine-2,4-diamine (CAS 1346602-49-0) is a chemical compound with the molecular formula C14H18N4O2 and a molecular weight of 280.35 g/mol. IUPAC name: 5-[[2-methyl-4,5-bis(trideuteriomethoxy)phenyl]methyl]pyrimidine-2,4-diamine. InChIKey: KEEYRKYKLYARHO-XERRXZQWSA-N.
| Molecular formula | C14H18N4O2 |
|---|---|
| Molecular weight | 280.35 g/mol |
| IUPAC name | 5-[[2-methyl-4,5-bis(trideuteriomethoxy)phenyl]methyl]pyrimidine-2,4-diamine |
| InChIKey | KEEYRKYKLYARHO-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C(=C1)C)CC2=CN=C(N=C2N)N)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)