CAS 1006448-73-2 is the registry number for 5-Methyl-4-((4-methyl-1H-pyrazol-1-yl)methyl)thiophene-2-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methyl-4-[(4-methylpyrazol-1-yl)methyl]thiophene-2-carbaldehyde (CAS 1006448-73-2) is a chemical compound with the molecular formula C11H12N2OS and a molecular weight of 220.29 g/mol. IUPAC name: 5-methyl-4-[(4-methylpyrazol-1-yl)methyl]thiophene-2-carbaldehyde. InChIKey: XNQGRRRZPFSHND-UHFFFAOYSA-N.
| Molecular formula | C11H12N2OS |
|---|---|
| Molecular weight | 220.29 g/mol |
| IUPAC name | 5-methyl-4-[(4-methylpyrazol-1-yl)methyl]thiophene-2-carbaldehyde |
| InChIKey | XNQGRRRZPFSHND-UHFFFAOYSA-N |
| SMILES | CC1=CN(N=C1)CC2=C(SC(=C2)C=O)C |
Computed by PubChem (NCBI)