CAS 1006468-57-0 is the registry number for 4-(3,5-Dimethyl-1h-pyrazol-1-yl)-3-fluoroaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
4-(3,5-dimethylpyrazol-1-yl)-3-fluoroaniline (CAS 1006468-57-0) is a chemical compound with the molecular formula C11H12FN3 and a molecular weight of 205.23 g/mol. IUPAC name: 4-(3,5-dimethylpyrazol-1-yl)-3-fluoroaniline. InChIKey: SOMUJVAHUCSAPU-UHFFFAOYSA-N.
| Molecular formula | C11H12FN3 |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 4-(3,5-dimethylpyrazol-1-yl)-3-fluoroaniline |
| InChIKey | SOMUJVAHUCSAPU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN1C2=C(C=C(C=C2)N)F)C |
Computed by PubChem (NCBI)