Products 1015845-64-3
CAS 1015845-64-3 is the registry number for 1-(3-Fluorobenzyl)-4-methyl-1h-pyrazol-5-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
1-[(3-fluorophenyl)methyl]-4-methylpyrazol-5-amine (CAS 1015845-64-3) is a chemical compound with the molecular formula C11H12FN3 and a molecular weight of 205.23 g/mol. IUPAC name: 1-[(3-fluorophenyl)methyl]-4-methylpyrazol-5-amine. InChIKey: ZZTPGCPCJPLFTI-UHFFFAOYSA-N.
| Molecular formula | C11H12FN3 |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 1-[(3-fluorophenyl)methyl]-4-methylpyrazol-5-amine |
| InChIKey | ZZTPGCPCJPLFTI-UHFFFAOYSA-N |
| SMILES | CC1=C(N(N=C1)CC2=CC(=CC=C2)F)N |
Computed by PubChem (NCBI)