Products 1375069-33-2
CAS 1375069-33-2 is the registry number for 1-Cyclopentyl-6-fluoro-1,2,3-benzotriazole, 97%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1-cyclopentyl-6-fluorobenzotriazole (CAS 1375069-33-2) is a chemical compound with the molecular formula C11H12FN3 and a molecular weight of 205.23 g/mol. IUPAC name: 1-cyclopentyl-6-fluorobenzotriazole. InChIKey: WBYLLWQKDZVUOV-UHFFFAOYSA-N.
| Molecular formula | C11H12FN3 |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 1-cyclopentyl-6-fluorobenzotriazole |
| InChIKey | WBYLLWQKDZVUOV-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)N2C3=C(C=CC(=C3)F)N=N2 |
Computed by PubChem (NCBI)