CAS 1006471-09-5 appears in our catalog under these names: 4-Bromo-1-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxylic acid, 95%, 4-Bromo-1-(2,2,2-trifluoroethyl)-1H-pyrazole-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid (CAS 1006471-09-5) is a chemical compound with the molecular formula C6H4BrF3N2O2 and a molecular weight of 273.01 g/mol. IUPAC name: 4-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid. InChIKey: PFIKFQQILFWVAC-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2O2 |
|---|---|
| Molecular weight | 273.01 g/mol |
| IUPAC name | 4-bromo-1-(2,2,2-trifluoroethyl)pyrazole-3-carboxylic acid |
| InChIKey | PFIKFQQILFWVAC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN1CC(F)(F)F)C(=O)O)Br |
Computed by PubChem (NCBI)