CAS 2103703-44-0 is the registry number for Methyl 4-bromo-3-(trifluoromethyl)-1H-pyrazole-5-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 4-bromo-5-(trifluoromethyl)-1H-pyrazole-3-carboxylate (CAS 2103703-44-0) is a chemical compound with the molecular formula C6H4BrF3N2O2 and a molecular weight of 273.01 g/mol. IUPAC name: methyl 4-bromo-5-(trifluoromethyl)-1H-pyrazole-3-carboxylate. InChIKey: UBNAAWVCLXVQJV-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2O2 |
|---|---|
| Molecular weight | 273.01 g/mol |
| IUPAC name | methyl 4-bromo-5-(trifluoromethyl)-1H-pyrazole-3-carboxylate |
| InChIKey | UBNAAWVCLXVQJV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NNC(=C1Br)C(F)(F)F |
Computed by PubChem (NCBI)