Products 497833-05-3

CAS 497833-05-3 is the registry number for 4-Bromo-1-methyl-3-(trifluoromethyl)-1H-pyrazole-5-carboxylic Acid. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 2,5g, 250mg.

Structural formula: {0} (CAS {1})

4-bromo-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxylic acid (CAS 497833-05-3) is a chemical compound with the molecular formula C6H4BrF3N2O2 and a molecular weight of 273.01 g/mol. IUPAC name: 4-bromo-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxylic acid. InChIKey: YAJINUFLHMNOQR-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BrF3N2O2
Molecular weight273.01 g/mol
IUPAC name4-bromo-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxylic acid
InChIKeyYAJINUFLHMNOQR-UHFFFAOYSA-N
SMILESCN1C(=C(C(=N1)C(F)(F)F)Br)C(=O)O

Computed by PubChem (NCBI)