CAS 497833-05-3 is the registry number for 4-Bromo-1-methyl-3-(trifluoromethyl)-1H-pyrazole-5-carboxylic Acid. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 2,5g, 250mg.
4-bromo-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxylic acid (CAS 497833-05-3) is a chemical compound with the molecular formula C6H4BrF3N2O2 and a molecular weight of 273.01 g/mol. IUPAC name: 4-bromo-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxylic acid. InChIKey: YAJINUFLHMNOQR-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2O2 |
|---|---|
| Molecular weight | 273.01 g/mol |
| IUPAC name | 4-bromo-1-methyl-3-(trifluoromethyl)pyrazole-5-carboxylic acid |
| InChIKey | YAJINUFLHMNOQR-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C(=N1)C(F)(F)F)Br)C(=O)O |
Computed by PubChem (NCBI)