Products 100667-16-1

CAS 100667-16-1 appears in our catalog under these names: Dezocine Impurity 5, Dezocine Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

15-amino-4-hydroxy-1-methyltricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-8-one (CAS 100667-16-1) is a chemical compound with the molecular formula C16H21NO2 and a molecular weight of 259.34 g/mol. IUPAC name: 15-amino-4-hydroxy-1-methyltricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-8-one. InChIKey: DYLSYIAXCGUICD-UHFFFAOYSA-N.

Identity
Molecular formulaC16H21NO2
Molecular weight259.34 g/mol
IUPAC name15-amino-4-hydroxy-1-methyltricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-8-one
InChIKeyDYLSYIAXCGUICD-UHFFFAOYSA-N
SMILESCC12CCCCCC(C1N)C(=O)C3=C2C=C(C=C3)O

Computed by PubChem (NCBI)