Products 1006717-12-9
CAS 1006717-12-9 appears in our catalog under these names: 3,4-Di(methoxy-d3)-benzoic Acid Methyl Ester, Methyl 3,4-bis(methoxy-d3)benzoate. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 25mg, 50mg, 100 mg, 25 mg, 50 mg, 10 mg.
Methyl 3,4-bis(trideuteriomethoxy)benzoate (CAS 1006717-12-9) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 202.24 g/mol. IUPAC name: methyl 3,4-bis(trideuteriomethoxy)benzoate. InChIKey: BIGQPYZPEWAPBG-WFGJKAKNSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 202.24 g/mol |
| IUPAC name | methyl 3,4-bis(trideuteriomethoxy)benzoate |
| InChIKey | BIGQPYZPEWAPBG-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)C(=O)OC)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)