CAS 1006957-57-8 is the registry number for N-(2,5-Difluorobenzyl)-1-methyl-1H-pyrazol-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(2,5-difluorophenyl)methyl]-1-methylpyrazol-4-amine (CAS 1006957-57-8) is a chemical compound with the molecular formula C11H11F2N3 and a molecular weight of 223.22 g/mol. IUPAC name: N-[(2,5-difluorophenyl)methyl]-1-methylpyrazol-4-amine. InChIKey: BMLYIANOBUSENY-UHFFFAOYSA-N.
| Molecular formula | C11H11F2N3 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | N-[(2,5-difluorophenyl)methyl]-1-methylpyrazol-4-amine |
| InChIKey | BMLYIANOBUSENY-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)NCC2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)