Products 947012-77-3
CAS 947012-77-3 is the registry number for (3,4-Difluorophenyl)(1-methyl-1H-imidazol-2-yl)methanamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3,4-difluorophenyl)-(1-methylimidazol-2-yl)methanamine (CAS 947012-77-3) is a chemical compound with the molecular formula C11H11F2N3 and a molecular weight of 223.22 g/mol. IUPAC name: (3,4-difluorophenyl)-(1-methylimidazol-2-yl)methanamine. InChIKey: KNMUEJFWJANZDS-UHFFFAOYSA-N.
| Molecular formula | C11H11F2N3 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | (3,4-difluorophenyl)-(1-methylimidazol-2-yl)methanamine |
| InChIKey | KNMUEJFWJANZDS-UHFFFAOYSA-N |
| SMILES | CN1C=CN=C1C(C2=CC(=C(C=C2)F)F)N |
Computed by PubChem (NCBI)