CAS 1152821-00-5 is the registry number for 3,5-Difluoro-N-((1-methyl-1H-pyrazol-4-yl)methyl)aniline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3,5-difluoro-N-[(1-methylpyrazol-4-yl)methyl]aniline (CAS 1152821-00-5) is a chemical compound with the molecular formula C11H11F2N3 and a molecular weight of 223.22 g/mol. IUPAC name: 3,5-difluoro-N-[(1-methylpyrazol-4-yl)methyl]aniline. InChIKey: SZXCPLUNZBIPNU-UHFFFAOYSA-N.
| Molecular formula | C11H11F2N3 |
|---|---|
| Molecular weight | 223.22 g/mol |
| IUPAC name | 3,5-difluoro-N-[(1-methylpyrazol-4-yl)methyl]aniline |
| InChIKey | SZXCPLUNZBIPNU-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)CNC2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)