CAS 1007036-41-0 appears in our catalog under these names: Sodium (4-methyl-1,3-thiazol-2-yl)acetate, 95%, 2-Thiazoleacetic acid, 4-methyl-, sodium salt, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 500mg.
Sodium 2-(4-methyl-1,3-thiazol-2-yl)acetate (CAS 1007036-41-0) is a chemical compound with the molecular formula C6H6NNaO2S and a molecular weight of 179.17 g/mol. IUPAC name: sodium 2-(4-methyl-1,3-thiazol-2-yl)acetate. InChIKey: RQEZRGOLVACBTR-UHFFFAOYSA-M.
| Molecular formula | C6H6NNaO2S |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | sodium 2-(4-methyl-1,3-thiazol-2-yl)acetate |
| InChIKey | RQEZRGOLVACBTR-UHFFFAOYSA-M |
| SMILES | CC1=CSC(=N1)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)