CAS 1423030-93-6 appears in our catalog under these names: Sodium 2-(5-methyl-1,3-thiazol-2-yl)acetate, 95%, Sodium 2–(5–methyl–1,3–thiazol–2–yl)acetate, Sodium 2-(5-methyl-1,3-thiazol-2-yl)acetate. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 100mg, 2,5g, 250mg, 50mg, 500mg, 0,5g.
Sodium 2-(5-methyl-1,3-thiazol-2-yl)acetate (CAS 1423030-93-6) is a chemical compound with the molecular formula C6H6NNaO2S and a molecular weight of 179.17 g/mol. IUPAC name: sodium 2-(5-methyl-1,3-thiazol-2-yl)acetate. InChIKey: IIDLBAIVVRAPTG-UHFFFAOYSA-M.
| Molecular formula | C6H6NNaO2S |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | sodium 2-(5-methyl-1,3-thiazol-2-yl)acetate |
| InChIKey | IIDLBAIVVRAPTG-UHFFFAOYSA-M |
| SMILES | CC1=CN=C(S1)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)